ChemNet > CAS > 321309-32-4 1,2,3-benzothiadiazole-5-carbonyl chloride
321309-32-4 1,2,3-benzothiadiazole-5-carbonyl chloride
Produkt-Name |
1,2,3-benzothiadiazole-5-carbonyl chloride |
Molekulare Formel |
C7H3ClN2OS |
Molecular Weight |
198.6295 |
InChI |
InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-6-5(3-4)9-10-12-6/h1-3H |
CAS Registry Number |
321309-32-4 |
Molecular Structure |
|
Dichte |
1.577g/cm3 |
Schmelzpunkt |
94℃ |
Siedepunkt |
311°C at 760 mmHg |
Brechungsindex |
1.704 |
Flammpunkt |
141.9°C |
Gefahrensymbole |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|